C11H8ClN3O3S — CID 135933580
5-chloro-6-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]pyridine-3-carboxylic acid (PubChem CID 135933580) has the molecular formula C11H8ClN3O3S and a molecular weight of 297.72 g/mol. Its IUPAC name is 5-chloro-6-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]pyridine-3-carboxylic acid.
| Compound Name | 5-chloro-6-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 135933580 |
| Molecular Formula | C11H8ClN3O3S |
| Molecular Weight | 297.72 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | 5-chloro-6-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]pyridine-3-carboxylic acid |
| SMILES | Cc1cc(=O)[nH]c(Sc2ncc(C(=O)O)cc2Cl)n1 |
| InChI | InChI=1S/C11H8ClN3O3S/c1-5-2-8(16)15-11(14-5)19-9-7(12)3-6(4-13-9)10(17)18/h2-4H,1H3,(H,17,18)(H,14,15,16) |
| InChIKey | WUTNPIUEJSQGHP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.72 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |