C8H10N2O3S — CID 135410546
3-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]propanoic acid (PubChem CID 135410546) has the molecular formula C8H10N2O3S and a molecular weight of 214.25 g/mol. Its IUPAC name is 3-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]propanoic acid.
| Compound Name | 3-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 135410546 |
| Molecular Formula | C8H10N2O3S |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 3-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]propanoic acid |
| SMILES | Cc1cc(=O)[nH]c(SCCC(=O)O)n1 |
| InChI | InChI=1S/C8H10N2O3S/c1-5-4-6(11)10-8(9-5)14-3-2-7(12)13/h4H,2-3H2,1H3,(H,12,13)(H,9,10,11) |
| InChIKey | OHXCUDNQSRMZCI-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |