C18H22N2O3S — CID 135541950
6-[[6-oxo-4-(1-phenylethyl)-1H-pyrimidin-2-yl]sulfanyl]hexanoic acid (PubChem CID 135541950) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is 6-[[6-oxo-4-(1-phenylethyl)-1H-pyrimidin-2-yl]sulfanyl]hexanoic acid.
| Compound Name | 6-[[6-oxo-4-(1-phenylethyl)-1H-pyrimidin-2-yl]sulfanyl]hexanoic acid |
|---|---|
| PubChem CID | 135541950 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 6-[[6-oxo-4-(1-phenylethyl)-1H-pyrimidin-2-yl]sulfanyl]hexanoic acid |
| SMILES | CC(c1ccccc1)c1cc(=O)[nH]c(SCCCCCC(=O)O)n1 |
| InChI | InChI=1S/C18H22N2O3S/c1-13(14-8-4-2-5-9-14)15-12-16(21)20-18(19-15)24-11-7-3-6-10-17(22)23/h2,4-5,8-9,12-13H,3,6-7,10-11H2,1H3,(H,22,23)(H,19,20,21) |
| InChIKey | PMFVQJMUQSKFPN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|