C15H24N2O3S — CID 136871940
2-decylsulfanyl-6-oxo-1H-pyrimidine-4-carboxylic acid (PubChem CID 136871940) has the molecular formula C15H24N2O3S and a molecular weight of 312.44 g/mol. Its IUPAC name is 2-decylsulfanyl-6-oxo-1H-pyrimidine-4-carboxylic acid.
| Compound Name | 2-decylsulfanyl-6-oxo-1H-pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 136871940 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 2-decylsulfanyl-6-oxo-1H-pyrimidine-4-carboxylic acid |
| SMILES | CCCCCCCCCCSc1nc(C(=O)O)cc(=O)[nH]1 |
| InChI | InChI=1S/C15H24N2O3S/c1-2-3-4-5-6-7-8-9-10-21-15-16-12(14(19)20)11-13(18)17-15/h11H,2-10H2,1H3,(H,19,20)(H,16,17,18) |
| InChIKey | ZPEDFUXQZLGNTK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|