C9H7IN4O2S — CID 136981731
2-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)sulfanyl]-4-methyl-1H-pyrimidin-6-one (PubChem CID 136981731) has the molecular formula C9H7IN4O2S and a molecular weight of 362.15 g/mol. Its IUPAC name is 2-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)sulfanyl]-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)sulfanyl]-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136981731 |
| Molecular Formula | C9H7IN4O2S |
| Molecular Weight | 362.15 g/mol |
| Exact Mass | 361.93 |
| IUPAC Name | 2-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)sulfanyl]-4-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1cc(=O)[nH]c(Sc2nc[nH]c(=O)c2I)n1 |
| InChI | InChI=1S/C9H7IN4O2S/c1-4-2-5(15)14-9(13-4)17-8-6(10)7(16)11-3-12-8/h2-3H,1H3,(H,11,12,16)(H,13,14,15) |
| InChIKey | ZAXRFNBPZIUPNY-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.15 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|