C10H5F2IN2OS — CID 114791080
4-(2,4-difluorophenyl)sulfanyl-5-iodo-1H-pyrimidin-6-one (PubChem CID 114791080) has the molecular formula C10H5F2IN2OS and a molecular weight of 366.13 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)sulfanyl-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-(2,4-difluorophenyl)sulfanyl-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114791080 |
| Molecular Formula | C10H5F2IN2OS |
| Molecular Weight | 366.13 g/mol |
| Exact Mass | 365.91 |
| IUPAC Name | 4-(2,4-difluorophenyl)sulfanyl-5-iodo-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(Sc2ccc(F)cc2F)c1I |
| InChI | InChI=1S/C10H5F2IN2OS/c11-5-1-2-7(6(12)3-5)17-10-8(13)9(16)14-4-15-10/h1-4H,(H,14,15,16) |
| InChIKey | SOOQACYWDQSPCZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.13 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|