C9H8BrN5OS — CID 136996671
2-(6-amino-5-bromopyrimidin-4-yl)sulfanyl-4-methyl-1H-pyrimidin-6-one (PubChem CID 136996671) has the molecular formula C9H8BrN5OS and a molecular weight of 314.17 g/mol. Its IUPAC name is 2-(6-amino-5-bromopyrimidin-4-yl)sulfanyl-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-(6-amino-5-bromopyrimidin-4-yl)sulfanyl-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136996671 |
| Molecular Formula | C9H8BrN5OS |
| Molecular Weight | 314.17 g/mol |
| Exact Mass | 312.96 |
| IUPAC Name | 2-(6-amino-5-bromopyrimidin-4-yl)sulfanyl-4-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1cc(=O)[nH]c(Sc2ncnc(N)c2Br)n1 |
| InChI | InChI=1S/C9H8BrN5OS/c1-4-2-5(16)15-9(14-4)17-8-6(10)7(11)12-3-13-8/h2-3H,1H3,(H2,11,12,13)(H,14,15,16) |
| InChIKey | GQPDTIDBASKDGR-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.17 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |