C12H14N4O3S2 — CID 135952294
3-amino-N-methyl-4-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]benzenesulfonamide (PubChem CID 135952294) has the molecular formula C12H14N4O3S2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 3-amino-N-methyl-4-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]benzenesulfonamide.
| Compound Name | 3-amino-N-methyl-4-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]benzenesulfonamide |
|---|---|
| PubChem CID | 135952294 |
| Molecular Formula | C12H14N4O3S2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 3-amino-N-methyl-4-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(Sc2nc(C)cc(=O)[nH]2)c(N)c1 |
| InChI | InChI=1S/C12H14N4O3S2/c1-7-5-11(17)16-12(15-7)20-10-4-3-8(6-9(10)13)21(18,19)14-2/h3-6,14H,13H2,1-2H3,(H,15,16,17) |
| InChIKey | OWOQGPPEPABYKW-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|