C14H16N4O2S — CID 135987401
4-amino-N-ethyl-2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]benzamide (PubChem CID 135987401) has the molecular formula C14H16N4O2S and a molecular weight of 304.38 g/mol. Its IUPAC name is 4-amino-N-ethyl-2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]benzamide.
| Compound Name | 4-amino-N-ethyl-2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]benzamide |
|---|---|
| PubChem CID | 135987401 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 4-amino-N-ethyl-2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]benzamide |
| SMILES | CCNC(=O)c1ccc(N)cc1Sc1nc(C)cc(=O)[nH]1 |
| InChI | InChI=1S/C14H16N4O2S/c1-3-16-13(20)10-5-4-9(15)7-11(10)21-14-17-8(2)6-12(19)18-14/h4-7H,3,15H2,1-2H3,(H,16,20)(H,17,18,19) |
| InChIKey | SONRPXFWTQOLDE-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|