C16H27N3O — CID 83141974
4-amino-N-ethyl-2-(2,3,3-trimethylbutylamino)benzamide (PubChem CID 83141974) has the molecular formula C16H27N3O and a molecular weight of 277.41 g/mol. Its IUPAC name is 4-amino-N-ethyl-2-(2,3,3-trimethylbutylamino)benzamide.
| Compound Name | 4-amino-N-ethyl-2-(2,3,3-trimethylbutylamino)benzamide |
|---|---|
| PubChem CID | 83141974 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | 4-amino-N-ethyl-2-(2,3,3-trimethylbutylamino)benzamide |
| SMILES | CCNC(=O)c1ccc(N)cc1NCC(C)C(C)(C)C |
| InChI | InChI=1S/C16H27N3O/c1-6-18-15(20)13-8-7-12(17)9-14(13)19-10-11(2)16(3,4)5/h7-9,11,19H,6,10,17H2,1-5H3,(H,18,20) |
| InChIKey | XCRFJGFMEJRYIQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|