C14H15N3O4S2 — CID 135964006
2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-(4-methylphenyl)sulfonylacetamide (PubChem CID 135964006) has the molecular formula C14H15N3O4S2 and a molecular weight of 353.43 g/mol. Its IUPAC name is 2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-(4-methylphenyl)sulfonylacetamide.
| Compound Name | 2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-(4-methylphenyl)sulfonylacetamide |
|---|---|
| PubChem CID | 135964006 |
| Molecular Formula | C14H15N3O4S2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-(4-methylphenyl)sulfonylacetamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)CSc2nc(C)cc(=O)[nH]2)cc1 |
| InChI | InChI=1S/C14H15N3O4S2/c1-9-3-5-11(6-4-9)23(20,21)17-13(19)8-22-14-15-10(2)7-12(18)16-14/h3-7H,8H2,1-2H3,(H,17,19)(H,15,16,18) |
| InChIKey | DBIMLZYRZVTLKW-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |