C9H9N5OS — CID 80893151
2-(6-amino-5-methylpyrimidin-4-yl)sulfanyl-1H-pyrimidin-6-one (PubChem CID 80893151) has the molecular formula C9H9N5OS and a molecular weight of 235.27 g/mol. Its IUPAC name is 2-(6-amino-5-methylpyrimidin-4-yl)sulfanyl-1H-pyrimidin-6-one.
| Compound Name | 2-(6-amino-5-methylpyrimidin-4-yl)sulfanyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 80893151 |
| Molecular Formula | C9H9N5OS |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | 2-(6-amino-5-methylpyrimidin-4-yl)sulfanyl-1H-pyrimidin-6-one |
| SMILES | Cc1c(N)ncnc1Sc1nccc(=O)[nH]1 |
| InChI | InChI=1S/C9H9N5OS/c1-5-7(10)12-4-13-8(5)16-9-11-3-2-6(15)14-9/h2-4H,1H3,(H2,10,12,13)(H,11,14,15) |
| InChIKey | XKKHQAXEWJFXKA-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |