C10H10FN5OS — CID 80893235
2-[2-(ethylamino)-5-fluoropyrimidin-4-yl]sulfanyl-1H-pyrimidin-6-one (PubChem CID 80893235) has the molecular formula C10H10FN5OS and a molecular weight of 267.29 g/mol. Its IUPAC name is 2-[2-(ethylamino)-5-fluoropyrimidin-4-yl]sulfanyl-1H-pyrimidin-6-one.
| Compound Name | 2-[2-(ethylamino)-5-fluoropyrimidin-4-yl]sulfanyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 80893235 |
| Molecular Formula | C10H10FN5OS |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 2-[2-(ethylamino)-5-fluoropyrimidin-4-yl]sulfanyl-1H-pyrimidin-6-one |
| SMILES | CCNc1ncc(F)c(Sc2nccc(=O)[nH]2)n1 |
| InChI | InChI=1S/C10H10FN5OS/c1-2-12-9-14-5-6(11)8(16-9)18-10-13-4-3-7(17)15-10/h3-5H,2H2,1H3,(H,12,14,16)(H,13,15,17) |
| InChIKey | HJHQIFVAWXNMMJ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |