C11H12FN5S — CID 80892715
N-ethyl-5-fluoro-4-(5-methylpyrimidin-2-yl)sulfanylpyrimidin-2-amine (PubChem CID 80892715) has the molecular formula C11H12FN5S and a molecular weight of 265.32 g/mol. Its IUPAC name is N-ethyl-5-fluoro-4-(5-methylpyrimidin-2-yl)sulfanylpyrimidin-2-amine.
| Compound Name | N-ethyl-5-fluoro-4-(5-methylpyrimidin-2-yl)sulfanylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80892715 |
| Molecular Formula | C11H12FN5S |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | N-ethyl-5-fluoro-4-(5-methylpyrimidin-2-yl)sulfanylpyrimidin-2-amine |
| SMILES | CCNc1ncc(F)c(Sc2ncc(C)cn2)n1 |
| InChI | InChI=1S/C11H12FN5S/c1-3-13-10-14-6-8(12)9(17-10)18-11-15-4-7(2)5-16-11/h4-6H,3H2,1-2H3,(H,13,14,17) |
| InChIKey | UJXICVZVMYRXAC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |