C10H16FN3OS — CID 107772815
3-[2-(ethylamino)-5-fluoropyrimidin-4-yl]sulfanylbutan-2-ol (PubChem CID 107772815) has the molecular formula C10H16FN3OS and a molecular weight of 245.32 g/mol. Its IUPAC name is 3-[2-(ethylamino)-5-fluoropyrimidin-4-yl]sulfanylbutan-2-ol.
| Compound Name | 3-[2-(ethylamino)-5-fluoropyrimidin-4-yl]sulfanylbutan-2-ol |
|---|---|
| PubChem CID | 107772815 |
| Molecular Formula | C10H16FN3OS |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 3-[2-(ethylamino)-5-fluoropyrimidin-4-yl]sulfanylbutan-2-ol |
| SMILES | CCNc1ncc(F)c(SC(C)C(C)O)n1 |
| InChI | InChI=1S/C10H16FN3OS/c1-4-12-10-13-5-8(11)9(14-10)16-7(3)6(2)15/h5-7,15H,4H2,1-3H3,(H,12,13,14) |
| InChIKey | TWANWPYWYFFMOU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |