C11H16FN3S — CID 80889927
4-cyclopentylsulfanyl-N-ethyl-5-fluoropyrimidin-2-amine (PubChem CID 80889927) has the molecular formula C11H16FN3S and a molecular weight of 241.33 g/mol. Its IUPAC name is 4-cyclopentylsulfanyl-N-ethyl-5-fluoropyrimidin-2-amine.
| Compound Name | 4-cyclopentylsulfanyl-N-ethyl-5-fluoropyrimidin-2-amine |
|---|---|
| PubChem CID | 80889927 |
| Molecular Formula | C11H16FN3S |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 4-cyclopentylsulfanyl-N-ethyl-5-fluoropyrimidin-2-amine |
| SMILES | CCNc1ncc(F)c(SC2CCCC2)n1 |
| InChI | InChI=1S/C11H16FN3S/c1-2-13-11-14-7-9(12)10(15-11)16-8-5-3-4-6-8/h7-8H,2-6H2,1H3,(H,13,14,15) |
| InChIKey | HDLHSSGPGWBYRG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |