C13H17N3S2 — CID 112750630
4-cyclopentylsulfanyl-N-ethylthieno[3,2-d]pyrimidin-2-amine (PubChem CID 112750630) has the molecular formula C13H17N3S2 and a molecular weight of 279.43 g/mol. Its IUPAC name is 4-cyclopentylsulfanyl-N-ethylthieno[3,2-d]pyrimidin-2-amine.
| Compound Name | 4-cyclopentylsulfanyl-N-ethylthieno[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 112750630 |
| Molecular Formula | C13H17N3S2 |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 4-cyclopentylsulfanyl-N-ethylthieno[3,2-d]pyrimidin-2-amine |
| SMILES | CCNc1nc(SC2CCCC2)c2sccc2n1 |
| InChI | InChI=1S/C13H17N3S2/c1-2-14-13-15-10-7-8-17-11(10)12(16-13)18-9-5-3-4-6-9/h7-9H,2-6H2,1H3,(H,14,15,16) |
| InChIKey | ITXUTFYLGLEJHF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |