C11H9NS2 — CID 10846537
8-ethyl-6,10-dithia-2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),4,8,11-pentaene (PubChem CID 10846537) has the molecular formula C11H9NS2 and a molecular weight of 219.33 g/mol. Its IUPAC name is 8-ethyl-6,10-dithia-2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),4,8,11-pentaene.
| Compound Name | 8-ethyl-6,10-dithia-2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),4,8,11-pentaene |
|---|---|
| PubChem CID | 10846537 |
| Molecular Formula | C11H9NS2 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.02 |
| IUPAC Name | 8-ethyl-6,10-dithia-2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),4,8,11-pentaene |
| SMILES | CCc1c2sccc2nc2ccsc12 |
| InChI | InChI=1S/C11H9NS2/c1-2-7-10-8(3-5-13-10)12-9-4-6-14-11(7)9/h3-6H,2H2,1H3 |
| InChIKey | LADQMRZYJQPTRO-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |