C10H8Cl2S — CID 130969196
5,7-dichloro-6-ethyl-1-benzothiophene (PubChem CID 130969196) has the molecular formula C10H8Cl2S and a molecular weight of 231.15 g/mol. Its IUPAC name is 5,7-dichloro-6-ethyl-1-benzothiophene.
| Compound Name | 5,7-dichloro-6-ethyl-1-benzothiophene |
|---|---|
| PubChem CID | 130969196 |
| Molecular Formula | C10H8Cl2S |
| Molecular Weight | 231.15 g/mol |
| Exact Mass | 229.97 |
| IUPAC Name | 5,7-dichloro-6-ethyl-1-benzothiophene |
| SMILES | CCc1c(Cl)cc2ccsc2c1Cl |
| InChI | InChI=1S/C10H8Cl2S/c1-2-7-8(11)5-6-3-4-13-10(6)9(7)12/h3-5H,2H2,1H3 |
| InChIKey | BMCFVUOPYUPNOS-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.15 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |