C12H13ClS — CID 131059958
5-chloro-4,7-diethyl-1-benzothiophene (PubChem CID 131059958) has the molecular formula C12H13ClS and a molecular weight of 224.76 g/mol. Its IUPAC name is 5-chloro-4,7-diethyl-1-benzothiophene.
| Compound Name | 5-chloro-4,7-diethyl-1-benzothiophene |
|---|---|
| PubChem CID | 131059958 |
| Molecular Formula | C12H13ClS |
| Molecular Weight | 224.76 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 5-chloro-4,7-diethyl-1-benzothiophene |
| SMILES | CCc1c(Cl)cc(CC)c2sccc12 |
| InChI | InChI=1S/C12H13ClS/c1-3-8-7-11(13)9(4-2)10-5-6-14-12(8)10/h5-7H,3-4H2,1-2H3 |
| InChIKey | LIENWCLFWIEGEA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.76 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |