C10H15ClN4S — CID 80890101
4-chloro-6-cyclopentylsulfanyl-N-ethyl-1,3,5-triazin-2-amine (PubChem CID 80890101) has the molecular formula C10H15ClN4S and a molecular weight of 258.78 g/mol. Its IUPAC name is 4-chloro-6-cyclopentylsulfanyl-N-ethyl-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-6-cyclopentylsulfanyl-N-ethyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80890101 |
| Molecular Formula | C10H15ClN4S |
| Molecular Weight | 258.78 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 4-chloro-6-cyclopentylsulfanyl-N-ethyl-1,3,5-triazin-2-amine |
| SMILES | CCNc1nc(Cl)nc(SC2CCCC2)n1 |
| InChI | InChI=1S/C10H15ClN4S/c1-2-12-9-13-8(11)14-10(15-9)16-7-5-3-4-6-7/h7H,2-6H2,1H3,(H,12,13,14,15) |
| InChIKey | OXPWAUJDEHPZTJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.78 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |