C11H16FN3OS — CID 106497884
N-ethyl-5-fluoro-4-(oxolan-2-ylmethylsulfanyl)pyrimidin-2-amine (PubChem CID 106497884) has the molecular formula C11H16FN3OS and a molecular weight of 257.33 g/mol. Its IUPAC name is N-ethyl-5-fluoro-4-(oxolan-2-ylmethylsulfanyl)pyrimidin-2-amine.
| Compound Name | N-ethyl-5-fluoro-4-(oxolan-2-ylmethylsulfanyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 106497884 |
| Molecular Formula | C11H16FN3OS |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | N-ethyl-5-fluoro-4-(oxolan-2-ylmethylsulfanyl)pyrimidin-2-amine |
| SMILES | CCNc1ncc(F)c(SCC2CCCO2)n1 |
| InChI | InChI=1S/C11H16FN3OS/c1-2-13-11-14-6-9(12)10(15-11)17-7-8-4-3-5-16-8/h6,8H,2-5,7H2,1H3,(H,13,14,15) |
| InChIKey | FIMBTXSAQXDPPE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |