C11H12FN5OS — CID 80893871
2-[5-fluoro-2-(propylamino)pyrimidin-4-yl]sulfanyl-1H-pyrimidin-6-one (PubChem CID 80893871) has the molecular formula C11H12FN5OS and a molecular weight of 281.32 g/mol. Its IUPAC name is 2-[5-fluoro-2-(propylamino)pyrimidin-4-yl]sulfanyl-1H-pyrimidin-6-one.
| Compound Name | 2-[5-fluoro-2-(propylamino)pyrimidin-4-yl]sulfanyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 80893871 |
| Molecular Formula | C11H12FN5OS |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 2-[5-fluoro-2-(propylamino)pyrimidin-4-yl]sulfanyl-1H-pyrimidin-6-one |
| SMILES | CCCNc1ncc(F)c(Sc2nccc(=O)[nH]2)n1 |
| InChI | InChI=1S/C11H12FN5OS/c1-2-4-13-10-15-6-7(12)9(17-10)19-11-14-5-3-8(18)16-11/h3,5-6H,2,4H2,1H3,(H,13,15,17)(H,14,16,18) |
| InChIKey | RTZNXXLAJPDMIQ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |