C19H16N2O2S — CID 135585315
4-methyl-2-[(1S)-2-oxo-1,2-diphenylethyl]sulfanyl-1H-pyrimidin-6-one (PubChem CID 135585315) has the molecular formula C19H16N2O2S and a molecular weight of 336.42 g/mol. Its IUPAC name is 4-methyl-2-[(1S)-2-oxo-1,2-diphenylethyl]sulfanyl-1H-pyrimidin-6-one.
| Compound Name | 4-methyl-2-[(1S)-2-oxo-1,2-diphenylethyl]sulfanyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135585315 |
| Molecular Formula | C19H16N2O2S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 4-methyl-2-[(1S)-2-oxo-1,2-diphenylethyl]sulfanyl-1H-pyrimidin-6-one |
| SMILES | Cc1cc(=O)[nH]c(S[C@H](C(=O)c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C19H16N2O2S/c1-13-12-16(22)21-19(20-13)24-18(15-10-6-3-7-11-15)17(23)14-8-4-2-5-9-14/h2-12,18H,1H3,(H,20,21,22)/t18-/m0/s1 |
| InChIKey | UHISHGDTIQFCMF-SFHVURJKSA-N |
| XLogP | 3.79 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |