C18H16N4OS — CID 40647144
(2S)-2-(4,6-diaminopyrimidin-2-yl)sulfanyl-1,2-diphenylethanone (PubChem CID 40647144) has the molecular formula C18H16N4OS and a molecular weight of 336.42 g/mol. Its IUPAC name is (2S)-2-(4,6-diaminopyrimidin-2-yl)sulfanyl-1,2-diphenylethanone.
| Compound Name | (2S)-2-(4,6-diaminopyrimidin-2-yl)sulfanyl-1,2-diphenylethanone |
|---|---|
| PubChem CID | 40647144 |
| Molecular Formula | C18H16N4OS |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | (2S)-2-(4,6-diaminopyrimidin-2-yl)sulfanyl-1,2-diphenylethanone |
| SMILES | Nc1cc(N)nc(S[C@H](C(=O)c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C18H16N4OS/c19-14-11-15(20)22-18(21-14)24-17(13-9-5-2-6-10-13)16(23)12-7-3-1-4-8-12/h1-11,17H,(H4,19,20,21,22)/t17-/m0/s1 |
| InChIKey | MXFAEGNTLKLFQD-KRWDZBQOSA-N |
| XLogP | 3.36 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |