About (2S)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-phenylacetic acid
(2S)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-phenylacetic acid (PubChem CID 735994) has the molecular formula C14H14N2O2S
and a molecular weight of 274.35 g/mol. Its IUPAC name is (2S)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-phenylacetic acid.
Molecular Properties
| Compound Name | (2S)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-phenylacetic acid |
| PubChem CID | 735994 |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | (2S)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-phenylacetic acid |
| SMILES | Cc1cc(C)nc(S[C@H](C(=O)O)c2ccccc2)n1 |
| InChI | InChI=1S/C14H14N2O2S/c1-9-8-10(2)16-14(15-9)19-12(13(17)18)11-6-4-3-5-7-11/h3-8,12H,1-2H3,(H,17,18)/t12-/m0/s1 |
| InChIKey | PGTNEQSEGPLBKE-LBPRGKRZSA-N |
| XLogP | 3.01 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-phenylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-phenylacetic acid?
The IUPAC name of (2S)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-phenylacetic acid (CID 735994) is (2S)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-phenylacetic acid.
What is the SMILES notation for (2S)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-phenylacetic acid?
The canonical SMILES for (2S)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-phenylacetic acid is Cc1cc(C)nc(S[C@H](C(=O)O)c2ccccc2)n1.
What is the InChIKey of (2S)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-phenylacetic acid?
The InChIKey is PGTNEQSEGPLBKE-LBPRGKRZSA-N. The full InChI is InChI=1S/C14H14N2O2S/c1-9-8-10(2)16-14(15-9)19-12(13(17)18)11-6-4-3-5-7-11/h3-8,12H,1-2H3,(H,17,18)/t12-/m0/s1.
What are the key properties of (2S)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-phenylacetic acid?
(2S)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-phenylacetic acid has a molecular weight of 274.35 g/mol, XLogP of 3.01, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-phenylacetic acid is sourced from PubChem (CID 735994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).