C23H18N2O2S — CID 132587435
2-(6-methyl-4-phenylquinazolin-2-yl)sulfanyl-2-phenylacetic acid (PubChem CID 132587435) has the molecular formula C23H18N2O2S and a molecular weight of 386.48 g/mol. Its IUPAC name is 2-(6-methyl-4-phenylquinazolin-2-yl)sulfanyl-2-phenylacetic acid.
| Compound Name | 2-(6-methyl-4-phenylquinazolin-2-yl)sulfanyl-2-phenylacetic acid |
|---|---|
| PubChem CID | 132587435 |
| Molecular Formula | C23H18N2O2S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 2-(6-methyl-4-phenylquinazolin-2-yl)sulfanyl-2-phenylacetic acid |
| SMILES | Cc1ccc2nc(SC(C(=O)O)c3ccccc3)nc(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C23H18N2O2S/c1-15-12-13-19-18(14-15)20(16-8-4-2-5-9-16)25-23(24-19)28-21(22(26)27)17-10-6-3-7-11-17/h2-14,21H,1H3,(H,26,27) |
| InChIKey | FSZWQZQZEBKTAC-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |