C25H20N2OS — CID 5177649
2-(4-methyl-6-phenylpyrimidin-2-yl)sulfanyl-1,2-diphenylethanone (PubChem CID 5177649) has the molecular formula C25H20N2OS and a molecular weight of 396.52 g/mol. Its IUPAC name is 2-(4-methyl-6-phenylpyrimidin-2-yl)sulfanyl-1,2-diphenylethanone.
| Compound Name | 2-(4-methyl-6-phenylpyrimidin-2-yl)sulfanyl-1,2-diphenylethanone |
|---|---|
| PubChem CID | 5177649 |
| Molecular Formula | C25H20N2OS |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 2-(4-methyl-6-phenylpyrimidin-2-yl)sulfanyl-1,2-diphenylethanone |
| SMILES | Cc1cc(-c2ccccc2)nc(SC(C(=O)c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C25H20N2OS/c1-18-17-22(19-11-5-2-6-12-19)27-25(26-18)29-24(21-15-9-4-10-16-21)23(28)20-13-7-3-8-14-20/h2-17,24H,1H3 |
| InChIKey | DCMRXVDONVTMIC-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |