C19H16N2O2S — CID 3059947
2-(4-methyl-6-phenylpyrimidin-2-yl)sulfanyl-2-phenylacetic acid (PubChem CID 3059947) has the molecular formula C19H16N2O2S and a molecular weight of 336.42 g/mol. Its IUPAC name is 2-(4-methyl-6-phenylpyrimidin-2-yl)sulfanyl-2-phenylacetic acid.
| Compound Name | 2-(4-methyl-6-phenylpyrimidin-2-yl)sulfanyl-2-phenylacetic acid |
|---|---|
| PubChem CID | 3059947 |
| Molecular Formula | C19H16N2O2S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 2-(4-methyl-6-phenylpyrimidin-2-yl)sulfanyl-2-phenylacetic acid |
| SMILES | Cc1cc(-c2ccccc2)nc(SC(C(=O)O)c2ccccc2)n1 |
| InChI | InChI=1S/C19H16N2O2S/c1-13-12-16(14-8-4-2-5-9-14)21-19(20-13)24-17(18(22)23)15-10-6-3-7-11-15/h2-12,17H,1H3,(H,22,23) |
| InChIKey | UFEIWPLHGOHKFM-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |