C21H20N2O2S — CID 143568576
2-[[4-methyl-3-(methylamino)-6-phenyl-2-pyridinyl]sulfanyl]-2-phenylacetic acid (PubChem CID 143568576) has the molecular formula C21H20N2O2S and a molecular weight of 364.47 g/mol. Its IUPAC name is 2-[[4-methyl-3-(methylamino)-6-phenyl-2-pyridinyl]sulfanyl]-2-phenylacetic acid.
| Compound Name | 2-[[4-methyl-3-(methylamino)-6-phenyl-2-pyridinyl]sulfanyl]-2-phenylacetic acid |
|---|---|
| PubChem CID | 143568576 |
| Molecular Formula | C21H20N2O2S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 2-[[4-methyl-3-(methylamino)-6-phenyl-2-pyridinyl]sulfanyl]-2-phenylacetic acid |
| SMILES | CNc1c(C)cc(-c2ccccc2)nc1SC(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C21H20N2O2S/c1-14-13-17(15-9-5-3-6-10-15)23-20(18(14)22-2)26-19(21(24)25)16-11-7-4-8-12-16/h3-13,19,22H,1-2H3,(H,24,25) |
| InChIKey | WRKBJQAPUNPEGQ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |