C21H23N3O2 — CID 4729055
butan-2-yl 2-[(6-methyl-4-phenylquinazolin-2-yl)amino]acetate (PubChem CID 4729055) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is butan-2-yl 2-[(6-methyl-4-phenylquinazolin-2-yl)amino]acetate.
| Compound Name | butan-2-yl 2-[(6-methyl-4-phenylquinazolin-2-yl)amino]acetate |
|---|---|
| PubChem CID | 4729055 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | butan-2-yl 2-[(6-methyl-4-phenylquinazolin-2-yl)amino]acetate |
| SMILES | CCC(C)OC(=O)CNc1nc(-c2ccccc2)c2cc(C)ccc2n1 |
| InChI | InChI=1S/C21H23N3O2/c1-4-15(3)26-19(25)13-22-21-23-18-11-10-14(2)12-17(18)20(24-21)16-8-6-5-7-9-16/h5-12,15H,4,13H2,1-3H3,(H,22,23,24) |
| InChIKey | DEJFXJOKMZVPLO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |