C23H22N4 — CID 3851416
4-N,4-N-dimethyl-1-N-(6-methyl-4-phenylquinazolin-2-yl)benzene-1,4-diamine (PubChem CID 3851416) has the molecular formula C23H22N4 and a molecular weight of 354.46 g/mol. Its IUPAC name is 4-N,4-N-dimethyl-1-N-(6-methyl-4-phenylquinazolin-2-yl)benzene-1,4-diamine.
| Compound Name | 4-N,4-N-dimethyl-1-N-(6-methyl-4-phenylquinazolin-2-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 3851416 |
| Molecular Formula | C23H22N4 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 4-N,4-N-dimethyl-1-N-(6-methyl-4-phenylquinazolin-2-yl)benzene-1,4-diamine |
| SMILES | Cc1ccc2nc(Nc3ccc(N(C)C)cc3)nc(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C23H22N4/c1-16-9-14-21-20(15-16)22(17-7-5-4-6-8-17)26-23(25-21)24-18-10-12-19(13-11-18)27(2)3/h4-15H,1-3H3,(H,24,25,26) |
| InChIKey | UOFZZKGMCRDTCZ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|