C20H16ClN5 — CID 90254100
6-chloro-N-(4,6-dimethylpyrimidin-2-yl)-4-phenylquinazolin-2-amine (PubChem CID 90254100) has the molecular formula C20H16ClN5 and a molecular weight of 361.84 g/mol. Its IUPAC name is 6-chloro-N-(4,6-dimethylpyrimidin-2-yl)-4-phenylquinazolin-2-amine.
| Compound Name | 6-chloro-N-(4,6-dimethylpyrimidin-2-yl)-4-phenylquinazolin-2-amine |
|---|---|
| PubChem CID | 90254100 |
| Molecular Formula | C20H16ClN5 |
| Molecular Weight | 361.84 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 6-chloro-N-(4,6-dimethylpyrimidin-2-yl)-4-phenylquinazolin-2-amine |
| SMILES | Cc1cc(C)nc(Nc2nc(-c3ccccc3)c3cc(Cl)ccc3n2)n1 |
| InChI | InChI=1S/C20H16ClN5/c1-12-10-13(2)23-19(22-12)26-20-24-17-9-8-15(21)11-16(17)18(25-20)14-6-4-3-5-7-14/h3-11H,1-2H3,(H,22,23,24,25,26) |
| InChIKey | HNZJONNEZIWNDN-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.84 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |