C23H15ClN6 — CID 6184611
6-chloro-4-phenyl-N-[(Z)-quinoxalin-6-ylmethylideneamino]quinazolin-2-amine (PubChem CID 6184611) has the molecular formula C23H15ClN6 and a molecular weight of 410.87 g/mol. Its IUPAC name is 6-chloro-4-phenyl-N-[(Z)-quinoxalin-6-ylmethylideneamino]quinazolin-2-amine.
| Compound Name | 6-chloro-4-phenyl-N-[(Z)-quinoxalin-6-ylmethylideneamino]quinazolin-2-amine |
|---|---|
| PubChem CID | 6184611 |
| Molecular Formula | C23H15ClN6 |
| Molecular Weight | 410.87 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 6-chloro-4-phenyl-N-[(Z)-quinoxalin-6-ylmethylideneamino]quinazolin-2-amine |
| SMILES | Clc1ccc2nc(N/N=C\c3ccc4nccnc4c3)nc(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C23H15ClN6/c24-17-7-9-19-18(13-17)22(16-4-2-1-3-5-16)29-23(28-19)30-27-14-15-6-8-20-21(12-15)26-11-10-25-20/h1-14H,(H,28,29,30)/b27-14- |
| InChIKey | BBZZACKEAGNELV-VYYCAZPPSA-N |
| XLogP | 5.34 |
| TPSA | 75.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.87 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|