C27H22ClN5O — CID 2830444
N-[(2-chloro-7-ethoxyquinolin-3-yl)methylideneamino]-6-methyl-4-phenylquinazolin-2-amine (PubChem CID 2830444) has the molecular formula C27H22ClN5O and a molecular weight of 467.96 g/mol. Its IUPAC name is N-[(2-chloro-7-ethoxyquinolin-3-yl)methylideneamino]-6-methyl-4-phenylquinazolin-2-amine.
| Compound Name | N-[(2-chloro-7-ethoxyquinolin-3-yl)methylideneamino]-6-methyl-4-phenylquinazolin-2-amine |
|---|---|
| PubChem CID | 2830444 |
| Molecular Formula | C27H22ClN5O |
| Molecular Weight | 467.96 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | N-[(2-chloro-7-ethoxyquinolin-3-yl)methylideneamino]-6-methyl-4-phenylquinazolin-2-amine |
| SMILES | CCOc1ccc2cc(C=NNc3nc(-c4ccccc4)c4cc(C)ccc4n3)c(Cl)nc2c1 |
| InChI | InChI=1S/C27H22ClN5O/c1-3-34-21-11-10-19-14-20(26(28)30-24(19)15-21)16-29-33-27-31-23-12-9-17(2)13-22(23)25(32-27)18-7-5-4-6-8-18/h4-16H,3H2,1-2H3,(H,31,32,33) |
| InChIKey | KQRAWSWUNMQUJF-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 72.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.96 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|