C25H19N5O — CID 135529630
3-[(E)-[(6-methyl-4-phenylquinazolin-2-yl)hydrazinylidene]methyl]-1H-quinolin-2-one (PubChem CID 135529630) has the molecular formula C25H19N5O and a molecular weight of 405.46 g/mol. Its IUPAC name is 3-[(E)-[(6-methyl-4-phenylquinazolin-2-yl)hydrazinylidene]methyl]-1H-quinolin-2-one.
| Compound Name | 3-[(E)-[(6-methyl-4-phenylquinazolin-2-yl)hydrazinylidene]methyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 135529630 |
| Molecular Formula | C25H19N5O |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 3-[(E)-[(6-methyl-4-phenylquinazolin-2-yl)hydrazinylidene]methyl]-1H-quinolin-2-one |
| SMILES | Cc1ccc2nc(N/N=C/c3cc4ccccc4[nH]c3=O)nc(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C25H19N5O/c1-16-11-12-22-20(13-16)23(17-7-3-2-4-8-17)29-25(28-22)30-26-15-19-14-18-9-5-6-10-21(18)27-24(19)31/h2-15H,1H3,(H,27,31)(H,28,29,30)/b26-15+ |
| InChIKey | VOWPSODHKBMKSR-CVKSISIWSA-N |
| XLogP | 4.89 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|