C22H16N6 — CID 136853822
N-[(Z)-1H-benzimidazol-2-ylmethylideneamino]-4-phenylquinazolin-2-amine (PubChem CID 136853822) has the molecular formula C22H16N6 and a molecular weight of 364.41 g/mol. Its IUPAC name is N-[(Z)-1H-benzimidazol-2-ylmethylideneamino]-4-phenylquinazolin-2-amine.
| Compound Name | N-[(Z)-1H-benzimidazol-2-ylmethylideneamino]-4-phenylquinazolin-2-amine |
|---|---|
| PubChem CID | 136853822 |
| Molecular Formula | C22H16N6 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | N-[(Z)-1H-benzimidazol-2-ylmethylideneamino]-4-phenylquinazolin-2-amine |
| SMILES | C(=N\Nc1nc(-c2ccccc2)c2ccccc2n1)\c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C22H16N6/c1-2-8-15(9-3-1)21-16-10-4-5-11-17(16)26-22(27-21)28-23-14-20-24-18-12-6-7-13-19(18)25-20/h1-14H,(H,24,25)(H,26,27,28)/b23-14- |
| InChIKey | KYGVAEMRRNYWPU-UCQKPKSFSA-N |
| XLogP | 4.62 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|