C23H18N4O2 — CID 75534449
N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-7-methyl-4-phenylquinazolin-2-amine (PubChem CID 75534449) has the molecular formula C23H18N4O2 and a molecular weight of 382.42 g/mol. Its IUPAC name is N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-7-methyl-4-phenylquinazolin-2-amine.
| Compound Name | N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-7-methyl-4-phenylquinazolin-2-amine |
|---|---|
| PubChem CID | 75534449 |
| Molecular Formula | C23H18N4O2 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-7-methyl-4-phenylquinazolin-2-amine |
| SMILES | Cc1ccc2c(-c3ccccc3)nc(N/N=C/c3ccc4c(c3)OCO4)nc2c1 |
| InChI | InChI=1S/C23H18N4O2/c1-15-7-9-18-19(11-15)25-23(26-22(18)17-5-3-2-4-6-17)27-24-13-16-8-10-20-21(12-16)29-14-28-20/h2-13H,14H2,1H3,(H,25,26,27)/b24-13+ |
| InChIKey | WGVBKFFAPSULTP-ZMOGYAJESA-N |
| XLogP | 4.78 |
| TPSA | 68.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|