About N-(1,3-benzodioxol-5-ylmethylideneamino)-3-methyl-1-phenylpyrazolo[3,4-b]pyridin-4-amine
N-(1,3-benzodioxol-5-ylmethylideneamino)-3-methyl-1-phenylpyrazolo[3,4-b]pyridin-4-amine (PubChem CID 66891539) has the molecular formula C21H17N5O2
and a molecular weight of 371.40 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethylideneamino)-3-methyl-1-phenylpyrazolo[3,4-b]pyridin-4-amine.
Molecular Properties
| Compound Name | N-(1,3-benzodioxol-5-ylmethylideneamino)-3-methyl-1-phenylpyrazolo[3,4-b]pyridin-4-amine |
| PubChem CID | 66891539 |
| Molecular Formula | C21H17N5O2 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethylideneamino)-3-methyl-1-phenylpyrazolo[3,4-b]pyridin-4-amine |
| SMILES | Cc1nn(-c2ccccc2)c2nccc(NN=Cc3ccc4c(c3)OCO4)c12 |
| InChI | InChI=1S/C21H17N5O2/c1-14-20-17(24-23-12-15-7-8-18-19(11-15)28-13-27-18)9-10-22-21(20)26(25-14)16-5-3-2-4-6-16/h2-12H,13H2,1H3,(H,22,24) |
| InChIKey | XZTKZHKQWIYNHS-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(1,3-benzodioxol-5-ylmethylideneamino)-3-methyl-1-phenylpyrazolo[3,4-b]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-benzodioxol-5-ylmethylideneamino)-3-methyl-1-phenylpyrazolo[3,4-b]pyridin-4-amine?
The IUPAC name of N-(1,3-benzodioxol-5-ylmethylideneamino)-3-methyl-1-phenylpyrazolo[3,4-b]pyridin-4-amine (CID 66891539) is N-(1,3-benzodioxol-5-ylmethylideneamino)-3-methyl-1-phenylpyrazolo[3,4-b]pyridin-4-amine.
What is the SMILES notation for N-(1,3-benzodioxol-5-ylmethylideneamino)-3-methyl-1-phenylpyrazolo[3,4-b]pyridin-4-amine?
The canonical SMILES for N-(1,3-benzodioxol-5-ylmethylideneamino)-3-methyl-1-phenylpyrazolo[3,4-b]pyridin-4-amine is Cc1nn(-c2ccccc2)c2nccc(NN=Cc3ccc4c(c3)OCO4)c12.
What is the InChIKey of N-(1,3-benzodioxol-5-ylmethylideneamino)-3-methyl-1-phenylpyrazolo[3,4-b]pyridin-4-amine?
The InChIKey is XZTKZHKQWIYNHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17N5O2/c1-14-20-17(24-23-12-15-7-8-18-19(11-15)28-13-27-18)9-10-22-21(20)26(25-14)16-5-3-2-4-6-16/h2-12H,13H2,1H3,(H,22,24).
What are the key properties of N-(1,3-benzodioxol-5-ylmethylideneamino)-3-methyl-1-phenylpyrazolo[3,4-b]pyridin-4-amine?
N-(1,3-benzodioxol-5-ylmethylideneamino)-3-methyl-1-phenylpyrazolo[3,4-b]pyridin-4-amine has a molecular weight of 371.40 g/mol, XLogP of 3.90, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-benzodioxol-5-ylmethylideneamino)-3-methyl-1-phenylpyrazolo[3,4-b]pyridin-4-amine is sourced from PubChem (CID 66891539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).