C19H14N6O2 — CID 6069357
N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-1-naphthalen-1-yltetrazol-5-amine (PubChem CID 6069357) has the molecular formula C19H14N6O2 and a molecular weight of 358.36 g/mol. Its IUPAC name is N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-1-naphthalen-1-yltetrazol-5-amine.
| Compound Name | N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-1-naphthalen-1-yltetrazol-5-amine |
|---|---|
| PubChem CID | 6069357 |
| Molecular Formula | C19H14N6O2 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-1-naphthalen-1-yltetrazol-5-amine |
| SMILES | C(=N\Nc1nnnn1-c1cccc2ccccc12)\c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H14N6O2/c1-2-6-15-14(4-1)5-3-7-16(15)25-19(22-23-24-25)21-20-11-13-8-9-17-18(10-13)27-12-26-17/h1-11H,12H2,(H,21,22,24)/b20-11- |
| InChIKey | VTDCSKXQEUULRF-JAIQZWGSSA-N |
| XLogP | 2.99 |
| TPSA | 86.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|