C18H14N6O — CID 135799290
4-[(E)-[(1-naphthalen-1-yltetrazol-5-yl)hydrazinylidene]methyl]phenol (PubChem CID 135799290) has the molecular formula C18H14N6O and a molecular weight of 330.35 g/mol. Its IUPAC name is 4-[(E)-[(1-naphthalen-1-yltetrazol-5-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 4-[(E)-[(1-naphthalen-1-yltetrazol-5-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135799290 |
| Molecular Formula | C18H14N6O |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 4-[(E)-[(1-naphthalen-1-yltetrazol-5-yl)hydrazinylidene]methyl]phenol |
| SMILES | Oc1ccc(/C=N/Nc2nnnn2-c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C18H14N6O/c25-15-10-8-13(9-11-15)12-19-20-18-21-22-23-24(18)17-7-3-5-14-4-1-2-6-16(14)17/h1-12,25H,(H,20,21,23)/b19-12+ |
| InChIKey | SCPKHSVYKDOQPK-XDHOZWIPSA-N |
| XLogP | 2.97 |
| TPSA | 88.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|