C11H14N6O — CID 135890939
4-[(Z)-[(4-amino-5-ethyl-1,2,4-triazol-3-yl)hydrazinylidene]methyl]phenol (PubChem CID 135890939) has the molecular formula C11H14N6O and a molecular weight of 246.27 g/mol. Its IUPAC name is 4-[(Z)-[(4-amino-5-ethyl-1,2,4-triazol-3-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 4-[(Z)-[(4-amino-5-ethyl-1,2,4-triazol-3-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135890939 |
| Molecular Formula | C11H14N6O |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 4-[(Z)-[(4-amino-5-ethyl-1,2,4-triazol-3-yl)hydrazinylidene]methyl]phenol |
| SMILES | CCc1nnc(N/N=C\c2ccc(O)cc2)n1N |
| InChI | InChI=1S/C11H14N6O/c1-2-10-14-16-11(17(10)12)15-13-7-8-3-5-9(18)6-4-8/h3-7,18H,2,12H2,1H3,(H,15,16)/b13-7- |
| InChIKey | TVVGGJOMXBEFHQ-QPEQYQDCSA-N |
| XLogP | 0.71 |
| TPSA | 101.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|