C13H19ClN6O2 — CID 21230362
3-N-[(Z)-(2,4-dimethoxyphenyl)methylideneamino]-5-ethyl-1,2,4-triazole-3,4-diamine;hydrochloride (PubChem CID 21230362) has the molecular formula C13H19ClN6O2 and a molecular weight of 326.79 g/mol. Its IUPAC name is 3-N-[(Z)-(2,4-dimethoxyphenyl)methylideneamino]-5-ethyl-1,2,4-triazole-3,4-diamine;hydrochloride.
| Compound Name | 3-N-[(Z)-(2,4-dimethoxyphenyl)methylideneamino]-5-ethyl-1,2,4-triazole-3,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 21230362 |
| Molecular Formula | C13H19ClN6O2 |
| Molecular Weight | 326.79 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 3-N-[(Z)-(2,4-dimethoxyphenyl)methylideneamino]-5-ethyl-1,2,4-triazole-3,4-diamine;hydrochloride |
| SMILES | CCc1nnc(N/N=C\c2ccc(OC)cc2OC)n1N.Cl |
| InChI | InChI=1S/C13H18N6O2.ClH/c1-4-12-16-18-13(19(12)14)17-15-8-9-5-6-10(20-2)7-11(9)21-3;/h5-8H,4,14H2,1-3H3,(H,17,18);1H/b15-8-; |
| InChIKey | CITRFSQECZYULQ-ZTXYIFKNSA-N |
| XLogP | 1.44 |
| TPSA | 99.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.79 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|