C13H16Cl2N6O3S — CID 73449418
5-[[(4-amino-5-ethyl-1,2,4-triazol-3-yl)hydrazinylidene]methyl]-7-methoxy-1,3-benzoxathiol-2-one;dihydrochloride (PubChem CID 73449418) has the molecular formula C13H16Cl2N6O3S and a molecular weight of 407.28 g/mol. Its IUPAC name is 5-[[(4-amino-5-ethyl-1,2,4-triazol-3-yl)hydrazinylidene]methyl]-7-methoxy-1,3-benzoxathiol-2-one;dihydrochloride.
| Compound Name | 5-[[(4-amino-5-ethyl-1,2,4-triazol-3-yl)hydrazinylidene]methyl]-7-methoxy-1,3-benzoxathiol-2-one;dihydrochloride |
|---|---|
| PubChem CID | 73449418 |
| Molecular Formula | C13H16Cl2N6O3S |
| Molecular Weight | 407.28 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | 5-[[(4-amino-5-ethyl-1,2,4-triazol-3-yl)hydrazinylidene]methyl]-7-methoxy-1,3-benzoxathiol-2-one;dihydrochloride |
| SMILES | CCc1nnc(NN=Cc2cc(OC)c3oc(=O)sc3c2)n1N.Cl.Cl |
| InChI | InChI=1S/C13H14N6O3S.2ClH/c1-3-10-16-18-12(19(10)14)17-15-6-7-4-8(21-2)11-9(5-7)23-13(20)22-11;;/h4-6H,3,14H2,1-2H3,(H,17,18);2*1H |
| InChIKey | ULLCOUGFRLZUEF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 120.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thio_carbonate_B(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|