C14H21ClN6 — CID 90486004
5-ethyl-3-N-[(E)-(4-propan-2-ylphenyl)methylideneamino]-1,2,4-triazole-3,4-diamine;hydrochloride (PubChem CID 90486004) has the molecular formula C14H21ClN6 and a molecular weight of 308.82 g/mol. Its IUPAC name is 5-ethyl-3-N-[(E)-(4-propan-2-ylphenyl)methylideneamino]-1,2,4-triazole-3,4-diamine;hydrochloride.
| Compound Name | 5-ethyl-3-N-[(E)-(4-propan-2-ylphenyl)methylideneamino]-1,2,4-triazole-3,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 90486004 |
| Molecular Formula | C14H21ClN6 |
| Molecular Weight | 308.82 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 5-ethyl-3-N-[(E)-(4-propan-2-ylphenyl)methylideneamino]-1,2,4-triazole-3,4-diamine;hydrochloride |
| SMILES | CCc1nnc(N/N=C/c2ccc(C(C)C)cc2)n1N.Cl |
| InChI | InChI=1S/C14H20N6.ClH/c1-4-13-17-19-14(20(13)15)18-16-9-11-5-7-12(8-6-11)10(2)3;/h5-10H,4,15H2,1-3H3,(H,18,19);1H/b16-9+; |
| InChIKey | BQWHWQDJDAOJQI-QOVZSLTQSA-N |
| XLogP | 2.55 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.82 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|