C17H26Cl2N8O2 — CID 171137505
5-ethyl-3-N-[[4-(4-methylpiperidin-1-yl)-3-nitrophenyl]methylideneamino]-1,2,4-triazole-3,4-diamine;dihydrochloride (PubChem CID 171137505) has the molecular formula C17H26Cl2N8O2 and a molecular weight of 445.36 g/mol. Its IUPAC name is 5-ethyl-3-N-[[4-(4-methylpiperidin-1-yl)-3-nitrophenyl]methylideneamino]-1,2,4-triazole-3,4-diamine;dihydrochloride.
| Compound Name | 5-ethyl-3-N-[[4-(4-methylpiperidin-1-yl)-3-nitrophenyl]methylideneamino]-1,2,4-triazole-3,4-diamine;dihydrochloride |
|---|---|
| PubChem CID | 171137505 |
| Molecular Formula | C17H26Cl2N8O2 |
| Molecular Weight | 445.36 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 5-ethyl-3-N-[[4-(4-methylpiperidin-1-yl)-3-nitrophenyl]methylideneamino]-1,2,4-triazole-3,4-diamine;dihydrochloride |
| SMILES | CCc1nnc(NN=Cc2ccc(N3CCC(C)CC3)c([N+](=O)[O-])c2)n1N.Cl.Cl |
| InChI | InChI=1S/C17H24N8O2.2ClH/c1-3-16-20-22-17(24(16)18)21-19-11-13-4-5-14(15(10-13)25(26)27)23-8-6-12(2)7-9-23;;/h4-5,10-12H,3,6-9,18H2,1-2H3,(H,21,22);2*1H |
| InChIKey | SAQQHIVZNAJIDX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 127.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|