C20H29N9O2 — CID 2855455
1-[[2,4-bis(4-methylpiperidin-1-yl)-5-nitrophenyl]methylideneamino]tetrazol-5-amine (PubChem CID 2855455) has the molecular formula C20H29N9O2 and a molecular weight of 427.51 g/mol. Its IUPAC name is 1-[[2,4-bis(4-methylpiperidin-1-yl)-5-nitrophenyl]methylideneamino]tetrazol-5-amine.
| Compound Name | 1-[[2,4-bis(4-methylpiperidin-1-yl)-5-nitrophenyl]methylideneamino]tetrazol-5-amine |
|---|---|
| PubChem CID | 2855455 |
| Molecular Formula | C20H29N9O2 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | 1-[[2,4-bis(4-methylpiperidin-1-yl)-5-nitrophenyl]methylideneamino]tetrazol-5-amine |
| SMILES | CC1CCN(c2cc(N3CCC(C)CC3)c([N+](=O)[O-])cc2C=Nn2nnnc2N)CC1 |
| InChI | InChI=1S/C20H29N9O2/c1-14-3-7-26(8-4-14)17-12-18(27-9-5-15(2)6-10-27)19(29(30)31)11-16(17)13-22-28-20(21)23-24-25-28/h11-15H,3-10H2,1-2H3,(H2,21,23,25) |
| InChIKey | NIECHPQJVNLILB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 131.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|