C22H29N5O3S — CID 171129785
5-[[2,4-bis(4-methylpiperidin-1-yl)-5-nitrophenyl]methylidene]-2-imino-1,3-thiazolidin-4-one (PubChem CID 171129785) has the molecular formula C22H29N5O3S and a molecular weight of 443.57 g/mol. Its IUPAC name is 5-[[2,4-bis(4-methylpiperidin-1-yl)-5-nitrophenyl]methylidene]-2-imino-1,3-thiazolidin-4-one.
| Compound Name | 5-[[2,4-bis(4-methylpiperidin-1-yl)-5-nitrophenyl]methylidene]-2-imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 171129785 |
| Molecular Formula | C22H29N5O3S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 5-[[2,4-bis(4-methylpiperidin-1-yl)-5-nitrophenyl]methylidene]-2-imino-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\NC(=O)C(=Cc2cc([N+](=O)[O-])c(N3CCC(C)CC3)cc2N2CCC(C)CC2)S1 |
| InChI | InChI=1S/C22H29N5O3S/c1-14-3-7-25(8-4-14)17-13-18(26-9-5-15(2)6-10-26)19(27(29)30)11-16(17)12-20-21(28)24-22(23)31-20/h11-15H,3-10H2,1-2H3,(H2,23,24,28) |
| InChIKey | IYJHEEWGTKMVMU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 102.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|