C11H7N3O5S — CID 154791244
(5Z)-2-imino-5-[(7-nitro-1,3-benzodioxol-5-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 154791244) has the molecular formula C11H7N3O5S and a molecular weight of 293.26 g/mol. Its IUPAC name is (5Z)-2-imino-5-[(7-nitro-1,3-benzodioxol-5-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-imino-5-[(7-nitro-1,3-benzodioxol-5-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 154791244 |
| Molecular Formula | C11H7N3O5S |
| Molecular Weight | 293.26 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | (5Z)-2-imino-5-[(7-nitro-1,3-benzodioxol-5-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\NC(=O)/C(=C/c2cc3c(c([N+](=O)[O-])c2)OCO3)S1 |
| InChI | InChI=1S/C11H7N3O5S/c12-11-13-10(15)8(20-11)3-5-1-6(14(16)17)9-7(2-5)18-4-19-9/h1-3H,4H2,(H2,12,13,15)/b8-3- |
| InChIKey | JUXZIBVSXMCMHC-BAQGIRSFSA-N |
| XLogP | 1.46 |
| TPSA | 114.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|