C15H16N2O2S — CID 173294551
(5Z)-5-[(2,2-dimethyl-3,4-dihydrochromen-6-yl)methylidene]-2-imino-1,3-thiazolidin-4-one (PubChem CID 173294551) has the molecular formula C15H16N2O2S and a molecular weight of 288.37 g/mol. Its IUPAC name is (5Z)-5-[(2,2-dimethyl-3,4-dihydrochromen-6-yl)methylidene]-2-imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(2,2-dimethyl-3,4-dihydrochromen-6-yl)methylidene]-2-imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 173294551 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | (5Z)-5-[(2,2-dimethyl-3,4-dihydrochromen-6-yl)methylidene]-2-imino-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\NC(=O)/C(=C/c2ccc3c(c2)CCC(C)(C)O3)S1 |
| InChI | InChI=1S/C15H16N2O2S/c1-15(2)6-5-10-7-9(3-4-11(10)19-15)8-12-13(18)17-14(16)20-12/h3-4,7-8H,5-6H2,1-2H3,(H2,16,17,18)/b12-8- |
| InChIKey | XVCCRWZBQNFPBD-WQLSENKSSA-N |
| XLogP | 2.93 |
| TPSA | 62.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|